Information card for entry 1501929
| Chemical name |
(R)-5,5'-Bis(diphenylphosphinoyl)-1,3,6,8,1',3',6',8'-octahydro- [4,4']bi[2,7-dioxaasindacenyl] |
| Formula |
C44 H36 O6 P2 |
| Calculated formula |
C44 H36 O6 P2 |
| SMILES |
P(=O)(c1c(c2c(c3c1COC3)COC2)c1c(P(=O)(c2ccccc2)c2ccccc2)c2COCc2c2COCc12)(c1ccccc1)c1ccccc1 |
| Title of publication |
Asymmetric synthesis of axially chiral biaryl diphosphine ligands by rhodium-catalyzed enantioselective intramolecular double [2 + 2 + 2] cycloaddition. |
| Authors of publication |
Mori, Fumiya; Fukawa, Naohiro; Noguchi, Keiichi; Tanaka, Ken |
| Journal of publication |
Organic letters |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
3 |
| Pages of publication |
362 - 365 |
| a |
15.7461 ± 0.0003 Å |
| b |
15.7461 ± 0.0003 Å |
| c |
11.9364 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
2563.01 ± 0.08 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
144 |
| Hermann-Mauguin space group symbol |
P 31 |
| Hall space group symbol |
P 31 |
| Residual factor for all reflections |
0.0312 |
| Residual factor for significantly intense reflections |
0.0306 |
| Weighted residual factors for significantly intense reflections |
0.0821 |
| Weighted residual factors for all reflections included in the refinement |
0.0826 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1501929.html