Information card for entry 1502168
| Formula |
C34 H46 N2 S2 Si2 |
| Calculated formula |
C34 H46 N2 S2 Si2 |
| SMILES |
c12c(c3cc4c(cc3c(c1N=S=N2)C#C[Si](C(C)C)(C(C)C)C(C)C)scc4)C#C[Si](C(C)C)(C(C)C)C(C)C |
| Title of publication |
Aceno[2,1,3]thiadiazoles for field-effect transistors: synthesis and crystal packing. |
| Authors of publication |
Lei, Ting; Zhou, Yan; Cheng, Chu-Yang; Cao, Yue; Peng, Yang; Bian, Jiang; Pei, Jian |
| Journal of publication |
Organic letters |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
10 |
| Pages of publication |
2642 - 2645 |
| a |
12.112 ± 0.002 Å |
| b |
18.039 ± 0.004 Å |
| c |
16.191 ± 0.003 Å |
| α |
90° |
| β |
94.77 ± 0.03° |
| γ |
90° |
| Cell volume |
3525.3 ± 1.2 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0922 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.0637 |
| Weighted residual factors for all reflections included in the refinement |
0.0703 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1502168.html