Information card for entry 1502295
| Formula |
C24 H31 N2 O6.5 |
| Calculated formula |
C24 H31 N2 O6.5 |
| SMILES |
O=C1O[C@@]23[C@@H]4N(CCC4)[C@@H](C2)[C@H](CC3=C1)C1=C2[C@]3([C@@H]4N(CCC4)[C@H]([C@H](O)C3)C2)OC1=O.O.O |
| Title of publication |
Flueggines A and B, Two New Dimeric Indolizidine Alkaloids from Flueggea virosa |
| Authors of publication |
Zhao, Bing-Xin; Wang, Ying; Zhang, Dong-Mei; Jiang, Ren-Wang; Wang, Guo-Cai; Shi, Jun-Min; Huang, Xiao-Jun; Chen, Wei-Min; Che, Chun-Tao; Ye, Wen-Cai |
| Journal of publication |
Organic Letters |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
15 |
| Pages of publication |
3888 - 3891 |
| a |
7.4783 ± 0.0006 Å |
| b |
11.5713 ± 0.0008 Å |
| c |
13.3812 ± 0.0009 Å |
| α |
107.895 ± 0.006° |
| β |
90.072 ± 0.006° |
| γ |
93.959 ± 0.006° |
| Cell volume |
1098.97 ± 0.14 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0492 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.1078 |
| Weighted residual factors for all reflections included in the refinement |
0.1172 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1502295.html