Information card for entry 1502586
| Formula |
C24 H20 N2 O2 |
| Calculated formula |
C24 H20 N2 O2 |
| SMILES |
O=C(OCC)c1n(c2ccccc2)c(nc1c1ccccc1)c1ccccc1 |
| Title of publication |
Catalyst-free preparation of 1,2,4,5-tetrasubstituted imidazoles from a novel unexpected domino reaction of 2-azido acrylates and nitrones. |
| Authors of publication |
Hu, Bao; Wang, Zhao; Ai, Ning; Zheng, Jie; Liu, Xing-Hai; Shan, Shang; Wang, Zhongwen |
| Journal of publication |
Organic letters |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
24 |
| Pages of publication |
6362 - 6365 |
| a |
8.797 ± 0.004 Å |
| b |
9.896 ± 0.005 Å |
| c |
22.154 ± 0.011 Å |
| α |
95.763 ± 0.01° |
| β |
92.756 ± 0.01° |
| γ |
98.775 ± 0.013° |
| Cell volume |
1892.5 ± 1.6 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0975 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.0759 |
| Weighted residual factors for all reflections included in the refinement |
0.1015 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1502586.html
