Information card for entry 1504654
| Chemical name |
cis-8-ethyl-3,13,13-trimethyl-2,3,4,4a,5,8,13,13a-octahydro-1H-indolo [3,2-a]acridine |
| Formula |
C24 H30 N2 |
| Calculated formula |
C24 H30 N2 |
| SMILES |
n1(c2ccccc2c2c3C(C)(C)[C@H]4CC[C@H](C)C[C@H]4Nc3ccc12)CC.n1(c2ccccc2c2c3C(C)(C)[C@@H]4CC[C@@H](C)C[C@@H]4Nc3ccc12)CC |
| Title of publication |
An Efficient, one-pot synthesis of isomeric ellipticine derivatives through intramolecular imino-Diels-Alder reaction |
| Authors of publication |
Gaddam, Vikram; Nagarajan, Rajagopal |
| Journal of publication |
Organic Letters |
| Year of publication |
2008 |
| Journal volume |
10 |
| Journal issue |
10 |
| Pages of publication |
1975 - 1978 |
| a |
12.68 ± 0.003 Å |
| b |
7.8737 ± 0.0017 Å |
| c |
20.108 ± 0.004 Å |
| α |
90° |
| β |
103.194 ± 0.004° |
| γ |
90° |
| Cell volume |
1954.6 ± 0.7 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.135 |
| Residual factor for significantly intense reflections |
0.1004 |
| Weighted residual factors for significantly intense reflections |
0.2085 |
| Weighted residual factors for all reflections included in the refinement |
0.2258 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.185 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1504654.html