Information card for entry 1507083
| Formula |
C17 H16 N2 O |
| Calculated formula |
C17 H16 N2 O |
| SMILES |
O[C@H]1[C@@H](N[C@@H](C#N)c2ccccc2)c2c(C1)cccc2 |
| Title of publication |
Epimerization of diastereomeric alpha-amino nitriles to single stereoisomers in the solid state. |
| Authors of publication |
Sakurai, Rumiko; Suzuki, Shuji; Hashimoto, Junichi; Baba, Manabu; Itoh, Osamu; Uchida, Akira; Hattori, Tetsutaro; Miyano, Sotaro; Yamaura, Masanori |
| Journal of publication |
Organic letters |
| Year of publication |
2004 |
| Journal volume |
6 |
| Journal issue |
13 |
| Pages of publication |
2241 - 2244 |
| a |
10.9347 ± 0.0014 Å |
| b |
5.099 ± 0.003 Å |
| c |
13.547 ± 0.002 Å |
| α |
90° |
| β |
109.07 ± 0.012° |
| γ |
90° |
| Cell volume |
713.9 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.123 |
| Residual factor for significantly intense reflections |
0.0496 |
| Weighted residual factors for significantly intense reflections |
0.0987 |
| Weighted residual factors for all reflections included in the refinement |
0.1292 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1507083.html