Information card for entry 1512254
| Formula |
C12 H15 N3 O2 S |
| Calculated formula |
C12 H15 N3 O2 S |
| SMILES |
COc1ccc(cc1)Nc1snc(n1)CC(O)C |
| Title of publication |
Novel 1,2,4-thiadiazole derivatives: crystal structure, conformational analysis, hydrogen bond networks, calculations, and thermodynamic characteristics of crystal lattices. |
| Authors of publication |
Surov, Artem O.; Bui, Cong Trinh; Proshin, Alexey N.; Roussel, Pascal; Idrissi, Abdenacer; Perlovich, German L. |
| Journal of publication |
The journal of physical chemistry. B |
| Year of publication |
2013 |
| Journal volume |
117 |
| Journal issue |
36 |
| Pages of publication |
10414 - 10429 |
| a |
11.299 ± 0.003 Å |
| b |
7.254 ± 0.002 Å |
| c |
15.444 ± 0.005 Å |
| α |
90° |
| β |
101.681 ± 0.005° |
| γ |
90° |
| Cell volume |
1239.6 ± 0.6 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0516 |
| Residual factor for significantly intense reflections |
0.0374 |
| Weighted residual factors for significantly intense reflections |
0.0923 |
| Weighted residual factors for all reflections included in the refinement |
0.0993 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1512254.html