Information card for entry 1513433
| Formula |
C18 H14 N2 O3 |
| Calculated formula |
C18 H14 N2 O3 |
| SMILES |
O=n1ccccc1NC(=O)c1ccccc1Oc1ccccc1 |
| Title of publication |
Copper-mediated direct aryloxylation of benzamides assisted by an n,o-bidentate directing group. |
| Authors of publication |
Hao, Xin-Qi; Chen, Li-Juan; Ren, Baozeng; Li, Liu-Yan; Yang, Xin-Yan; Gong, Jun-Fang; Niu, Jun-Long; Song, Mao-Ping |
| Journal of publication |
Organic letters |
| Year of publication |
2014 |
| Journal volume |
16 |
| Journal issue |
4 |
| Pages of publication |
1104 - 1107 |
| a |
6.0877 ± 0.0003 Å |
| b |
10.9989 ± 0.0008 Å |
| c |
11.2984 ± 0.0009 Å |
| α |
83.29 ± 0.006° |
| β |
87.571 ± 0.005° |
| γ |
83.717 ± 0.006° |
| Cell volume |
746.49 ± 0.09 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291.15 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0677 |
| Residual factor for significantly intense reflections |
0.0445 |
| Weighted residual factors for significantly intense reflections |
0.0991 |
| Weighted residual factors for all reflections included in the refinement |
0.1114 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1513433.html
