Information card for entry 1515933
| Formula |
C30 H51 N O4 S |
| Calculated formula |
C30 H51 N O4 S |
| SMILES |
S(CC[C@H](NC(=O)CC[C@H]([C@@H]1[C@]2(CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O)CC[C@]34C)[C@@H]2CC1)C)C)C(=O)OC)C |
| Title of publication |
Bile acid–amino acid ester conjugates: gelation, structural properties, and thermoreversible solid to solid phase transition |
| Authors of publication |
Noponen, Virpi; Nonappa,; Lahtinen, Manu; Valkonen, Arto; Salo, Hannu; Kolehmainen, Erkki; Sievänen, Elina |
| Journal of publication |
Soft Matter |
| Year of publication |
2010 |
| Journal volume |
6 |
| Journal issue |
16 |
| Pages of publication |
3789 |
| a |
9.9056 ± 0.0003 Å |
| b |
7.6387 ± 0.0003 Å |
| c |
19.5268 ± 0.0006 Å |
| α |
90° |
| β |
104.788 ± 0.002° |
| γ |
90° |
| Cell volume |
1428.57 ± 0.08 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.077 |
| Residual factor for significantly intense reflections |
0.0568 |
| Weighted residual factors for significantly intense reflections |
0.104 |
| Weighted residual factors for all reflections included in the refinement |
0.1134 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1515933.html