Information card for entry 1516783
| Formula |
C61 H51 N7 O6 |
| Calculated formula |
C61 H51 N7 O6 |
| SMILES |
O(c1cnc(c2nc(ccc2)c2ncc(OCOC)c(c2)C#Cc2cnc(cc2)c2ncc(cc2)c2c(cc(OC)cc2C)C)cc1C#Cc1cnc(cc1)c1ncc(cc1)c1c(cc(OC)cc1C)C)COC |
| Title of publication |
Linear bilateral extended 2,2′:6′,2′′-terpyridine ligands, their coordination complexes and heterometallic supramolecular networks |
| Authors of publication |
Veliks, Janis; Tseng, Jui-Chang; Arias, Karla I.; Weisshar, Florian; Linden, Anthony; Siegel, Jay S. |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2014 |
| Journal volume |
5 |
| Journal issue |
11 |
| Pages of publication |
4317 |
| a |
9.6372 ± 0.0002 Å |
| b |
13.2613 ± 0.0002 Å |
| c |
20.4245 ± 0.0004 Å |
| α |
79.8271 ± 0.0015° |
| β |
76.8586 ± 0.0016° |
| γ |
86.464 ± 0.0016° |
| Cell volume |
2501.34 ± 0.08 Å3 |
| Cell temperature |
160 ± 1 K |
| Ambient diffraction temperature |
160 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0602 |
| Residual factor for significantly intense reflections |
0.0428 |
| Weighted residual factors for significantly intense reflections |
0.1114 |
| Weighted residual factors for all reflections included in the refinement |
0.1212 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1516783.html
