Information card for entry 1518636
| Formula |
C46 H44 B3 N3 O7 |
| Calculated formula |
C46 H44 B3 N3 O7 |
| SMILES |
O(c1c(OC)c2c3c4c1B(Nc1c4c4c5c(NB(c4c(c1OC)OC)c1ccccc1)c(c(OC)c(B(N2)c1ccccc1)c35)OC)c1ccccc1)C.O1CCCC1 |
| Title of publication |
1,5,9-Triaza-2,6,10-triphenylboracoronene: BN-Embedded Analogue of Coronene. |
| Authors of publication |
Li, Gang; Xiong, Wei-Wei; Gu, Pei-Yang; Cao, Jun; Zhu, Jia; Ganguly, Rakesh; Li, Yongxin; Grimsdale, Andrew C.; Zhang, Qichun |
| Journal of publication |
Organic letters |
| Year of publication |
2015 |
| Journal volume |
17 |
| Journal issue |
3 |
| Pages of publication |
560 - 563 |
| a |
16.559 ± 0.003 Å |
| b |
16.774 ± 0.003 Å |
| c |
15.989 ± 0.003 Å |
| α |
90° |
| β |
115.658 ± 0.008° |
| γ |
90° |
| Cell volume |
4003.2 ± 1.3 Å3 |
| Cell temperature |
103 ± 2 K |
| Ambient diffraction temperature |
103 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.2341 |
| Residual factor for significantly intense reflections |
0.0956 |
| Weighted residual factors for significantly intense reflections |
0.2482 |
| Weighted residual factors for all reflections included in the refinement |
0.3405 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.996 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1518636.html