Information card for entry 1529232
| Chemical name |
Catena-(mu~4~-thiobarbiturato-O,O,O',S)sodium |
| Formula |
C8 H11 N2 Na O2 S |
| Calculated formula |
C8 H11 N2 Na O2 S |
| SMILES |
S=C1N(CC)C(=O)C=C([O-])N1CC.[Na+] |
| Title of publication |
The cis-trans isomer transformation, spectroscopic and thermal properties of Li, Na, K 1,3-diethyl-2-thiobarbiturate complexes |
| Authors of publication |
Golovnev, Nikolay; Molokeev, Maxim; Vereshchagin, Sergey; Sterkhova, Irina; Atuchin, Victor |
| Journal of publication |
Polyhedron |
| Year of publication |
2015 |
| Journal volume |
85 |
| Journal issue |
0 |
| Pages of publication |
493 |
| a |
10.5339 ± 0.0018 Å |
| b |
7.6036 ± 0.0013 Å |
| c |
14.186 ± 0.002 Å |
| α |
90° |
| β |
108.964 ± 0.004° |
| γ |
90° |
| Cell volume |
1074.6 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.114 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.1077 |
| Weighted residual factors for all reflections included in the refinement |
0.1317 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1529232.html