Information card for entry 1532493
| Formula |
C30 H33 B2 Br N2 O2 |
| Calculated formula |
C30 H33 B2 Br N2 O2 |
| SMILES |
[B]12(c3ccccc3)CC([B](C3=[N]1C(C)(C)CO3)(C1=[N]2C(CO1)(C)C)c1ccccc1)c1ccc(Br)cc1 |
| Title of publication |
Reversible [4 + 2] cycloaddition reaction of 1,3,2,5-diazadiborinine with ethylene |
| Authors of publication |
Wu, Di; Ganguly, Rakesh; Li, Yongxin; Hoo, Sin Ni; Hirao, Hajime; Kinjo, Rei |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2015 |
| Journal volume |
6 |
| Journal issue |
12 |
| Pages of publication |
7150 |
| a |
9.5066 ± 0.0006 Å |
| b |
9.248 ± 0.0005 Å |
| c |
30.632 ± 0.002 Å |
| α |
90° |
| β |
94.399 ± 0.003° |
| γ |
90° |
| Cell volume |
2685.1 ± 0.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1277 |
| Residual factor for significantly intense reflections |
0.0583 |
| Weighted residual factors for significantly intense reflections |
0.105 |
| Weighted residual factors for all reflections included in the refinement |
0.1268 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.986 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1532493.html