Information card for entry 1540546
| Formula |
C24 H40 B F Mg N6 |
| Calculated formula |
C24 H40 B F Mg N6 |
| SMILES |
[Mg]12(F)[n]3n(c(cc3C(C)(C)C)C)[BH](n3[n]1c(cc3C)C(C)(C)C)n1[n]2c(cc1C)C(C)(C)C |
| Title of publication |
Synthesis, structure and reactivity of a terminal magnesium fluoride compound, [TpBut,Me]MgF: hydrogen bonding, halogen bonding and C–F bond formation |
| Authors of publication |
Rauch, Michael; Ruccolo, Serge; Mester, John Paul; Rong, Yi; Parkin, Gerard |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2016 |
| Journal volume |
7 |
| Journal issue |
1 |
| Pages of publication |
142 |
| a |
9.422 ± 0.003 Å |
| b |
30.397 ± 0.009 Å |
| c |
9.544 ± 0.003 Å |
| α |
90° |
| β |
98.992 ± 0.004° |
| γ |
90° |
| Cell volume |
2699.8 ± 1.4 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0696 |
| Residual factor for significantly intense reflections |
0.0507 |
| Weighted residual factors for significantly intense reflections |
0.1234 |
| Weighted residual factors for all reflections included in the refinement |
0.1336 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1540546.html