Information card for entry 1542265
| Formula |
C42 H28 N2 O2 S2 |
| Calculated formula |
C42 H28 N2 O2 S2 |
| SMILES |
S(=O)(=O)(c1ccc(N2c3c(Sc4c2cccc4)cccc3)cc1)c1ccc(cc1)c1ccc(n2c3c(cccc3)c3c2cccc3)cc1 |
| Title of publication |
Achieving remarkable mechanochromism and white-light emission with thermally activated delayed fluorescence through the molecular heredity principle |
| Authors of publication |
Xu, Bingjia; Mu, Yingxiao; Mao, Zhu; Xie, Zongliang; Wu, Haozhong; Zhang, Yi; Jin, Chongjun; Chi, Zhenguo; Liu, Siwei; Xu, Jiarui; Wu, Yuan-Chun; Lu, Po-Yen; Lien, Alan; Bryce, Martin R. |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2016 |
| Journal volume |
7 |
| Journal issue |
3 |
| Pages of publication |
2201 |
| a |
19.365 ± 0.004 Å |
| b |
12.947 ± 0.003 Å |
| c |
13.257 ± 0.003 Å |
| α |
90° |
| β |
106.41 ± 0.03° |
| γ |
90° |
| Cell volume |
3188.4 ± 1.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0682 |
| Residual factor for significantly intense reflections |
0.0479 |
| Weighted residual factors for significantly intense reflections |
0.1133 |
| Weighted residual factors for all reflections included in the refinement |
0.1255 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1542265.html