Information card for entry 1542926
| Formula |
C34 H36 B N3 |
| Calculated formula |
C34 H36 B N3 |
| SMILES |
[B]1([n]2nc(n(c2c2c(C1)cccc2)C)c1ccccc1)(c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C |
| Title of publication |
1,1-Hydroboration of Fused Azole-Isoindole Analogues as an Approach for Construction of B,N-Heterocycles and Azole-Fused B,N-Naphthalenes. |
| Authors of publication |
Shi, Yong-Gang; Yang, Deng-Tao; Mellerup, Soren K.; Wang, Nan; Peng, Tai; Wang, Suning |
| Journal of publication |
Organic letters |
| Year of publication |
2016 |
| Journal volume |
18 |
| Journal issue |
7 |
| Pages of publication |
1626 - 1629 |
| a |
21.303 ± 0.003 Å |
| b |
13.582 ± 0.002 Å |
| c |
9.6038 ± 0.0012 Å |
| α |
90° |
| β |
95.171 ± 0.005° |
| γ |
90° |
| Cell volume |
2767.4 ± 0.7 Å3 |
| Cell temperature |
152 ± 2 K |
| Ambient diffraction temperature |
152 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0882 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.0965 |
| Weighted residual factors for all reflections included in the refinement |
0.1101 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1542926.html