Information card for entry 1542975
| Chemical name |
Bis[4-(5-anilino-1,3,4-thiadiazol-2-yl)pyridinium] sulfate |
| Formula |
C26 H22 N8 O4 S3 |
| Calculated formula |
C26 H22 N8 O4 S3 |
| SMILES |
s1c(nnc1Nc1ccccc1)c1cc[nH+]cc1.s1c(nnc1Nc1ccccc1)c1cc[nH+]cc1.S(=O)(=O)([O-])[O-] |
| Title of publication |
Bis[4-(5-anilino-1,3,4-thiadiazol-2-yl)pyridinium] sulfate |
| Authors of publication |
Bharti, Akhilesh; Nath, Paras; Bharati, Pooja; Gupta, Sushil K.; Bharty, Manoj K. |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
3 |
| Pages of publication |
x160446 |
| a |
7.4551 ± 0.0008 Å |
| b |
11.9212 ± 0.0013 Å |
| c |
15.1931 ± 0.0016 Å |
| α |
90.605 ± 0.006° |
| β |
99.245 ± 0.005° |
| γ |
105.408 ± 0.006° |
| Cell volume |
1282.8 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0356 |
| Residual factor for significantly intense reflections |
0.0301 |
| Weighted residual factors for significantly intense reflections |
0.0711 |
| Weighted residual factors for all reflections included in the refinement |
0.0742 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1542975.html