Information card for entry 1542980
| Chemical name |
(4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane-κ^8^<i>N</i>~2~,<i>O</i>~6~)rubidium 4,4'-bipyridinidyl |
| Formula |
C28 H44 N4 O6 Rb |
| Calculated formula |
C28 H44 N4 O6 Rb |
| SMILES |
[Rb]1234567[O]8CC[N]19CC[O]2CC[O]3CC[N]4(CC[O]5CC[O]6CC9)CC[O]7CC8.n1ccc(c2ccncc2)cc1 |
| Title of publication |
(4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane-κ^8^<i>N</i>~2~,<i>O</i>~6~)rubidium 4,4'-bipyridinidyl |
| Authors of publication |
Mayer, Kerstin; Klein, Wilhelm; Fässler, Thomas F. |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
3 |
| Pages of publication |
x160505 |
| a |
11.2326 ± 0.0004 Å |
| b |
8.025 ± 0.0003 Å |
| c |
16.3653 ± 0.0007 Å |
| α |
90° |
| β |
91.95 ± 0.003° |
| γ |
90° |
| Cell volume |
1474.34 ± 0.1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
13 |
| Hermann-Mauguin space group symbol |
P 1 2/n 1 |
| Hall space group symbol |
-P 2yac |
| Residual factor for all reflections |
0.0384 |
| Residual factor for significantly intense reflections |
0.0293 |
| Weighted residual factors for significantly intense reflections |
0.0622 |
| Weighted residual factors for all reflections included in the refinement |
0.0651 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1542980.html