Information card for entry 1543346
| Chemical name |
4-Methyl-<i>N</i>-(4-methylpyridin-2-yl)-<i>N</i>-(3,4,5,6-tetrahydro-2<i>H</i>-pyran-4-yl)pyridin-2-amine |
| Formula |
C17 H21 N3 O |
| Calculated formula |
C17 H21 N3 O |
| SMILES |
N(C1CCOCC1)(c1nccc(c1)C)c1nccc(c1)C |
| Title of publication |
4-Methyl-<i>N</i>-(4-methylpyridin-2-yl)-<i>N</i>-(3,4,5,6-tetrahydro-2<i>H</i>-pyran-4-yl)pyridin-2-amine |
| Authors of publication |
El-Gokha, Ahmed; Schollmeyer, Dieter; Koch, Pierre |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
5 |
| Pages of publication |
x160804 |
| a |
14.5487 ± 0.0009 Å |
| b |
10.1675 ± 0.0006 Å |
| c |
10.4269 ± 0.0006 Å |
| α |
90° |
| β |
100.104 ± 0.0017° |
| γ |
90° |
| Cell volume |
1518.47 ± 0.16 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0463 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.1137 |
| Weighted residual factors for all reflections included in the refinement |
0.1216 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543346.html