Information card for entry 1543483
| Chemical name |
2-[(2<i>Z</i>)-2-Benzylidene-3-oxo-3,4-dihydro-2<i>H</i>-1,4-benzothiazin-4-yl]acetic acid |
| Formula |
C17 H13 N O3 S |
| Calculated formula |
C17 H13 N O3 S |
| SMILES |
S1c2c(N(C(=O)C\1=C\c1ccccc1)CC(=O)O)cccc2 |
| Title of publication |
2-[(2<i>Z</i>)-2-Benzylidene-3-oxo-3,4-dihydro-2<i>H</i>-1,4-benzothiazin-4-yl]acetic acid |
| Authors of publication |
Sebbar, Nada Kheira; Ellouz, Mohamed; Mague, Joel T.; Ouzidan, Younes; Essassi, El Mokhtar; Zouihri, Hafid |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
6 |
| Pages of publication |
x160863 |
| a |
8.676 ± 0.0003 Å |
| b |
8.7882 ± 0.0003 Å |
| c |
9.8142 ± 0.0004 Å |
| α |
78.2 ± 0.001° |
| β |
73.311 ± 0.001° |
| γ |
86.242 ± 0.001° |
| Cell volume |
701.61 ± 0.04 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0333 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for significantly intense reflections |
0.0821 |
| Weighted residual factors for all reflections included in the refinement |
0.0831 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543483.html