Information card for entry 1543529
| Chemical name |
4,4'-([4,4'-Bipyridine]-1,1'-diium-1,1'-diyl)dibenzoate dihydrate |
| Formula |
C24 H20 N2 O6 |
| Calculated formula |
C24 H20 N2 O6 |
| SMILES |
O.[O-]C(=O)c1ccc([n+]2ccc(c3cc[n+](c4ccc(C(=O)[O-])cc4)cc3)cc2)cc1.O |
| Title of publication |
4,4'-([4,4'-Bipyridine]-1,1'-diium-1,1'-diyl)dibenzoate dihydrate |
| Authors of publication |
Rodriguez, Mark A.; Sava Gallis, Dorina F.; Chavez, James S.; Klivansky, Liana M.; Liu, Yi |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
6 |
| Pages of publication |
x160966 |
| a |
19.1437 ± 0.0006 Å |
| b |
7.642 ± 0.0003 Å |
| c |
13.2619 ± 0.0004 Å |
| α |
90° |
| β |
97.369 ± 0.001° |
| γ |
90° |
| Cell volume |
1924.14 ± 0.11 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0437 |
| Residual factor for significantly intense reflections |
0.0408 |
| Weighted residual factors for significantly intense reflections |
0.1347 |
| Weighted residual factors for all reflections included in the refinement |
0.1388 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.116 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543529.html