Information card for entry 1543624
| Chemical name |
2-[4-(4-Methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dihydro-1<i>H</i>-isoindole-1,3-dione |
| Formula |
C18 H12 N2 O3 S |
| Calculated formula |
C18 H12 N2 O3 S |
| SMILES |
s1cc(nc1N1C(=O)c2ccccc2C1=O)c1ccc(OC)cc1 |
| Title of publication |
2-[4-(4-Methoxyphenyl)-1,3-thiazol-2-yl]-2,3-dihydro-1<i>H</i>-isoindole-1,3-dione |
| Authors of publication |
Saravanan, K.; Archana, K.; Lakshmithendral, K.; Kabilan, S.; Selvanayagam, S. |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
7 |
| Pages of publication |
x161053 |
| a |
7.004 ± 0.009 Å |
| b |
14.054 ± 0.017 Å |
| c |
15.275 ± 0.019 Å |
| α |
90° |
| β |
90.368 ± 0.012° |
| γ |
90° |
| Cell volume |
1504 ± 3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1041 |
| Residual factor for significantly intense reflections |
0.0655 |
| Weighted residual factors for significantly intense reflections |
0.1724 |
| Weighted residual factors for all reflections included in the refinement |
0.2188 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.072 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543624.html