Information card for entry 1543683
| Chemical name |
2-[(5-Amino-1,3,4-thiadiazol-2-yl)sulfanyl]-<i>N</i>-(2,4,5-trichlorophenyl)acetamide |
| Formula |
C10 H7 Cl3 N4 O S2 |
| Calculated formula |
C10 H7 Cl3 N4 O S2 |
| SMILES |
Clc1cc(NC(=O)CSc2sc(nn2)N)c(Cl)cc1Cl |
| Title of publication |
2-[(5-Amino-1,3,4-thiadiazol-2-yl)sulfanyl]-<i>N</i>-(2,4,5-trichlorophenyl)acetamide |
| Authors of publication |
Madan Kumar, S.; Madhu Kumar, D. J.; Shivakumar, H. P.; Jagadeesha Prasad, D.; Byrappa, K.; Abdoh, M. M. M. |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
7 |
| Pages of publication |
x161123 |
| a |
12.4679 ± 0.0012 Å |
| b |
11.9467 ± 0.0011 Å |
| c |
9.5278 ± 0.0008 Å |
| α |
90° |
| β |
95.701 ± 0.007° |
| γ |
90° |
| Cell volume |
1412.1 ± 0.2 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273.15 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0757 |
| Residual factor for significantly intense reflections |
0.0507 |
| Weighted residual factors for significantly intense reflections |
0.1177 |
| Weighted residual factors for all reflections included in the refinement |
0.1283 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.094 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543683.html