Information card for entry 1543986
| Chemical name |
1,2,3,5-Tetramethyl-1<i>H</i>-pyrazol-2-ium triiodide |
| Formula |
C7 H13 I3 N2 |
| Calculated formula |
C7 H13 I3 N2 |
| SMILES |
I[I-]I.c1(cc(C)[n+](C)n1C)C |
| Title of publication |
1,2,3,5-Tetramethyl-1<i>H</i>-pyrazol-2-ium triiodide |
| Authors of publication |
Oberparleiter, Stefan; Laus, Gerhard; Wurst, Klaus; Schottenberger, Herwig |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
8 |
| Pages of publication |
x161331 |
| a |
9.6719 ± 0.0007 Å |
| b |
13.4005 ± 0.0009 Å |
| c |
11.1874 ± 0.0008 Å |
| α |
90° |
| β |
112.994 ± 0.002° |
| γ |
90° |
| Cell volume |
1334.77 ± 0.16 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0298 |
| Residual factor for significantly intense reflections |
0.0255 |
| Weighted residual factors for significantly intense reflections |
0.0583 |
| Weighted residual factors for all reflections included in the refinement |
0.0619 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.235 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1543986.html