Information card for entry 1544654
| Chemical name |
1,5-Dichloro-1,1,2,2,3,3,4,4,5,5-decaphenylpentasilane |
| Formula |
C60 H50 Cl2 Si5 |
| Calculated formula |
C60 H50 Cl2 Si5 |
| SMILES |
Cl[Si]([Si]([Si]([Si]([Si](Cl)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
1,5-Dichloro-1,1,2,2,3,3,4,4,5,5-decaphenylpentasilane |
| Authors of publication |
Neumeyer, Felix; Kotil, Leyla; Auner, Norbert; Bolte, Michael |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
11 |
| Pages of publication |
x161812 |
| a |
11.6675 ± 0.0006 Å |
| b |
33.682 ± 0.002 Å |
| c |
13.3653 ± 0.0007 Å |
| α |
90° |
| β |
94.184 ± 0.004° |
| γ |
90° |
| Cell volume |
5238.4 ± 0.5 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0779 |
| Residual factor for significantly intense reflections |
0.0703 |
| Weighted residual factors for significantly intense reflections |
0.1841 |
| Weighted residual factors for all reflections included in the refinement |
0.189 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544654.html