Information card for entry 1544769
| Chemical name |
Ethyl 4-(furan-2-yl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C12 H14 N2 O4 |
| Calculated formula |
C12 H14 N2 O4 |
| SMILES |
o1cccc1C1C(=C(NC(=O)N1)C)C(=O)OCC |
| Title of publication |
Ethyl 4-(furan-2-yl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate: a triclinic polymorph |
| Authors of publication |
Novina, J. J.; Vasuki, G.; Suresh, M.; Viswanathan, Vijayan; Velmurugan, Devadasan |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
12 |
| Pages of publication |
x161937 |
| a |
7.467 ± 0.0002 Å |
| b |
8.8307 ± 0.0003 Å |
| c |
10.5426 ± 0.0003 Å |
| α |
106.833 ± 0.002° |
| β |
108.557 ± 0.002° |
| γ |
99.42 ± 0.002° |
| Cell volume |
605.2 ± 0.03 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0476 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.117 |
| Weighted residual factors for all reflections included in the refinement |
0.1228 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544769.html