Information card for entry 1544771
| Chemical name |
9-Ethyl-6-methyl-7<i>H</i>-1,2,4-triazolo[4,3-<i>b</i>][1,2,4]triazepin-8(9<i>H</i>)-one |
| Formula |
C8 H11 N5 O |
| Calculated formula |
C8 H11 N5 O |
| SMILES |
O=C1N(c2n(N=C(C1)C)cnn2)CC |
| Title of publication |
9-Ethyl-6-methyl-7<i>H</i>-1,2,4-triazolo[4,3-<i>b</i>][1,2,4]triazepin-8(9<i>H</i>)-one |
| Authors of publication |
El Bakri, Youness; Harmaoui, Abdallah; Essassi, El Mokhtar; Saadi, Mohamed; El Ammari, Lahcen |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
12 |
| Pages of publication |
x161897 |
| a |
7.8989 ± 0.0003 Å |
| b |
8.088 ± 0.0003 Å |
| c |
8.2052 ± 0.0003 Å |
| α |
90.297 ± 0.002° |
| β |
113.319 ± 0.002° |
| γ |
98.488 ± 0.002° |
| Cell volume |
474.94 ± 0.03 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0537 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for significantly intense reflections |
0.1238 |
| Weighted residual factors for all reflections included in the refinement |
0.1325 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544771.html