Information card for entry 1544949
| Formula |
C12 H12.5 O4.25 |
| Calculated formula |
C12 H12.5 O4.25 |
| SMILES |
O=C(O)c1ccc2OC[C@@](O)(C=Cc2c1)C.O |
| Title of publication |
Dimericbiscognienyne A: A Meroterpenoid Dimer from Biscogniauxia sp. with New Skeleton and Its Activity. |
| Authors of publication |
Zhao, Huan; Chen, Guo-Dong; Zou, Jian; He, Rong-Rong; Qin, Sheng-Ying; Hu, Dan; Li, Guo-Qiang; Guo, Liang-Dong; Yao, Xin-Sheng; Gao, Hao |
| Journal of publication |
Organic letters |
| Year of publication |
2016 |
| a |
24.87 ± 0.0006 Å |
| b |
6.6662 ± 0.0001 Å |
| c |
13.8578 ± 0.0003 Å |
| α |
90° |
| β |
107.661 ± 0.002° |
| γ |
90° |
| Cell volume |
2189.18 ± 0.08 Å3 |
| Cell temperature |
173 ± 0.3 K |
| Ambient diffraction temperature |
173 ± 0.3 K |
| Number of distinct elements |
3 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0341 |
| Residual factor for significantly intense reflections |
0.0328 |
| Weighted residual factors for significantly intense reflections |
0.0873 |
| Weighted residual factors for all reflections included in the refinement |
0.0883 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.083 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544949.html