Information card for entry 1545253
| Formula |
C16 H9 F13 O2 |
| Calculated formula |
C16 H9 F13 O2 |
| SMILES |
O1c2c(C=O)cccc2CC1CC(F)(F)C(C(F)(C(C(F)(F)C(F)(F)F)(F)F)F)(F)F |
| Title of publication |
Palladium-Catalyzed Fluoroalkylative Cyclization of Olefins. |
| Authors of publication |
Liao, Jianhua; Fan, Lianfeng; Guo, Wei; Zhang, Zhenming; Li, Jiawei; Zhu, Chuanle; Ren, Yanwei; Wu, Wanqing; Jiang, Huanfeng |
| Journal of publication |
Organic letters |
| Year of publication |
2017 |
| Journal volume |
19 |
| Journal issue |
5 |
| Pages of publication |
1008 - 1011 |
| a |
5.5613 ± 0.0011 Å |
| b |
12.363 ± 0.003 Å |
| c |
13.729 ± 0.003 Å |
| α |
97.92 ± 0.03° |
| β |
99.81 ± 0.03° |
| γ |
99.47 ± 0.03° |
| Cell volume |
904 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.2112 |
| Residual factor for significantly intense reflections |
0.155 |
| Weighted residual factors for significantly intense reflections |
0.4315 |
| Weighted residual factors for all reflections included in the refinement |
0.4729 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.628 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1545253.html
