Information card for entry 1545421
| Formula |
C36 H36 O8 |
| Calculated formula |
C36 H36 O8 |
| SMILES |
O1c2cc(OCCCC#CC#CCCCOc3cc(OCCCC#CC#CCCC1)cc(c3)C(=O)OC)cc(c2)C(=O)OC |
| Title of publication |
Chromogenic Tubular Polydiacetylenes from Topochemical Polymerization of Self-Assembled Macrocyclic Diacetylenes |
| Authors of publication |
Heo, Jung-Moo; Kim, Youngmee; Han, Seulki; Joung, Joonyoung F.; Lee, Sang-hwa; Han, Sejin; Noh, Jaegeun; Kim, Jaeyong; Park, Sungnam; Lee, Haiwon; Choi, Yoon Mi; Jung, Young-Sik; Kim, Jong-Man |
| Journal of publication |
Macromolecules |
| Year of publication |
2017 |
| Journal volume |
50 |
| Journal issue |
3 |
| Pages of publication |
900 |
| a |
30.8999 ± 0.0007 Å |
| b |
4.6942 ± 0.0001 Å |
| c |
28.5604 ± 0.0007 Å |
| α |
90° |
| β |
120.027 ± 0.001° |
| γ |
90° |
| Cell volume |
3586.71 ± 0.15 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0709 |
| Residual factor for significantly intense reflections |
0.0623 |
| Weighted residual factors for significantly intense reflections |
0.1518 |
| Weighted residual factors for all reflections included in the refinement |
0.1565 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1545421.html