Information card for entry 1546042
| Formula |
C22 H31 B2 Br O4 |
| Calculated formula |
C22 H31 B2 Br O4 |
| SMILES |
Brc1ccc([C@@](C(B2OC(C(O2)(C)C)(C)C)=C)(C)B2OC(C(O2)(C)C)(C)C)cc1 |
| Title of publication |
Enantioselective Palladium-Catalyzed Diboration of 1,1-Disubstituted Allenes |
| Authors of publication |
Tang, Wenjun; Liu, Jiawang; Nie, Ming; Zhou, Qing-Hai; Gao, Shen; Jiang, Wenhao; Chung, Lung Wa; Ding, Kuiling |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2017 |
| a |
11.1006 ± 0.0017 Å |
| b |
6.9951 ± 0.001 Å |
| c |
30.827 ± 0.005 Å |
| α |
90° |
| β |
94.93 ± 0.003° |
| γ |
90° |
| Cell volume |
2384.9 ± 0.6 Å3 |
| Cell temperature |
130 K |
| Ambient diffraction temperature |
130 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0995 |
| Residual factor for significantly intense reflections |
0.0494 |
| Weighted residual factors for significantly intense reflections |
0.0935 |
| Weighted residual factors for all reflections included in the refinement |
0.1093 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.944 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546042.html