Information card for entry 1546655
| Chemical name |
9-(1<i>H</i>-Benzo[<i>d</i>]imidazol-2-yl)-2,3,6,7-tetrahydro-1<i>H</i>,5<i>H</i>-pyrido[3,2,1-<i>ij</i>]quinoline |
| Formula |
C19 H19 N3 |
| Calculated formula |
C19 H19 N3 |
| SMILES |
n1c([nH]c2c1cccc2)c1cc2CCCN3c2c(CCC3)c1 |
| Title of publication |
9-(1<i>H</i>-Benzo[<i>d</i>]imidazol-2-yl)-2,3,6,7-tetrahydro-1<i>H</i>,5<i>H</i>-pyrido[3,2,1-<i>ij</i>]quinoline |
| Authors of publication |
González, Gerardo García; Unnamatla, M. V. Basavanag |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
3 |
| Pages of publication |
x170445 |
| a |
14.054 ± 0.0011 Å |
| b |
11.2639 ± 0.0006 Å |
| c |
9.6184 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1522.62 ± 0.16 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0607 |
| Residual factor for significantly intense reflections |
0.0559 |
| Weighted residual factors for significantly intense reflections |
0.1484 |
| Weighted residual factors for all reflections included in the refinement |
0.1539 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546655.html