Information card for entry 1546713
| Chemical name |
1,1'-(Diphosphene-1,2-diyl)bis(2,2,6,6-tetramethylpiperidine) |
| Formula |
C18 H36 N2 P2 |
| Calculated formula |
C18 H36 N2 P2 |
| SMILES |
C1(CCCC(C)(C)N1/P=P/N1C(CCCC1(C)C)(C)C)(C)C |
| Title of publication |
1,1'-(Diphosphene-1,2-diyl)bis(2,2,6,6-tetramethylpiperidine) |
| Authors of publication |
Höhne, Martha; Spannenberg, Anke; Müller, Bernd H.; Rosenthal, Uwe |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
6 |
| Pages of publication |
x170903 |
| a |
11.3277 ± 0.0003 Å |
| b |
12.3257 ± 0.0003 Å |
| c |
15.5274 ± 0.0004 Å |
| α |
112.59 ± 0.0006° |
| β |
90.7806 ± 0.0007° |
| γ |
92.9221 ± 0.0007° |
| Cell volume |
1997.74 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0481 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0874 |
| Weighted residual factors for all reflections included in the refinement |
0.0949 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546713.html