Information card for entry 1547161
| Formula |
C40 H40 N4 O4 |
| Calculated formula |
C40 H40 N4 O4 |
| SMILES |
O(CCCC)c1c2c3c(c4c5c2c(OCCCC)c(cc5cc(c4OCCCC)C#N)C#N)c(OCCCC)c(cc3cc1C#N)C#N |
| Title of publication |
Bay- and Ortho-Octasubstituted Perylenes. |
| Authors of publication |
Li, Youpeng; Hong, Youhua; Guo, Jing; Huang, Xiaobo; Wei, Haipeng; Zhou, Jun; Qiu, Tiancheng; Wu, Jishan; Zeng, Zebing |
| Journal of publication |
Organic letters |
| Year of publication |
2017 |
| Journal volume |
19 |
| Journal issue |
19 |
| Pages of publication |
5094 - 5097 |
| a |
14.514 ± 0.004 Å |
| b |
10.865 ± 0.003 Å |
| c |
44.055 ± 0.011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
6947 ± 3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0465 |
| Residual factor for significantly intense reflections |
0.0427 |
| Weighted residual factors for significantly intense reflections |
0.1188 |
| Weighted residual factors for all reflections included in the refinement |
0.1257 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.6525 Å |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1547161.html