Information card for entry 1547232
| Formula |
C36 H40 N4 |
| Calculated formula |
C36 H40 N4 |
| SMILES |
C(=C(c1ccccc1)c1ccccc1)(c1ccc(cc1)N1CCN(C)CC1)c1ccc(cc1)N1CCN(C)CC1 |
| Title of publication |
An Acidic pH Independent Piperazine-TPE AIEgen as a Unique Bioprobe for Lysosome Tracing |
| Authors of publication |
Cai, Yuanjing; Gui, Chen; Samedov, Kerim; Su, Huifang; Gu, Xinggui; Li, Shiwu; Luo, Wenwen; Sung, Herman H-Y.; Lam, Jacky Wing Yip; Kwok, Ryan T. K.; Williams, Ian Duncan; Qin, Anjun; Tang, Ben Zhong |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2017 |
| a |
13.1123 ± 0.0013 Å |
| b |
20.584 ± 0.0016 Å |
| c |
11.26 ± 0.0009 Å |
| α |
90° |
| β |
99.391 ± 0.009° |
| γ |
90° |
| Cell volume |
2998.4 ± 0.5 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1569 |
| Residual factor for significantly intense reflections |
0.0679 |
| Weighted residual factors for significantly intense reflections |
0.099 |
| Weighted residual factors for all reflections included in the refinement |
0.1222 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1547232.html