Information card for entry 1547838
| Formula |
C15 H24 O3 |
| Calculated formula |
C15 H24 O3 |
| SMILES |
O1[C@@]2([C@H](O)CCC(=CCC([C@H]3O[C@@H]3C2)(C)C)C1)C.O1[C@]2([C@@H](O)CCC(=CCC([C@@H]3O[C@H]3C2)(C)C)C1)C |
| Title of publication |
Aquilanols A and B, Macrocyclic Humulene-Type Sesquiterpenoids from the Agarwood of Aquilaria malaccensis. |
| Authors of publication |
Ma, Chi Thanh; Eom, Taeyong; Cho, Eunji; Wu, Bo; Kim, Tae Ryong; Oh, Ki Bong; Han, Sang Beom; Kwon, Sung Won; Park, Jeong Hill |
| Journal of publication |
Journal of natural products |
| Year of publication |
2017 |
| Journal volume |
80 |
| Journal issue |
11 |
| Pages of publication |
3043 - 3048 |
| a |
11.6837 ± 0.0003 Å |
| b |
6.49484 ± 0.0002 Å |
| c |
18.4991 ± 0.0006 Å |
| α |
90° |
| β |
100.765 ± 0.003° |
| γ |
90° |
| Cell volume |
1379.08 ± 0.07 Å3 |
| Cell temperature |
295 ± 0.2 K |
| Ambient diffraction temperature |
295 ± 0.2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0473 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.1084 |
| Weighted residual factors for all reflections included in the refinement |
0.1154 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1547838.html