Information card for entry 1548569
| Chemical name |
3,4,5-trifluorophenylboroxine |
| Formula |
C18 H6 B3 F9 O3 |
| Calculated formula |
C18 H6 B3 F9 O3 |
| SMILES |
Fc1c(F)cc(cc1F)B1OB(OB(O1)c1cc(F)c(F)c(F)c1)c1cc(F)c(F)c(F)c1 |
| Title of publication |
Mechanistic insights into boron-catalysed direct amidation reactions. |
| Authors of publication |
Arkhipenko, Sergey; Sabatini, Marco T.; Batsanov, Andrei S.; Karaluka, Valerija; Sheppard, Tom D.; Rzepa, Henry S.; Whiting, Andrew |
| Journal of publication |
Chemical science |
| Year of publication |
2018 |
| Journal volume |
9 |
| Journal issue |
4 |
| Pages of publication |
1058 - 1072 |
| a |
12.8358 ± 0.0009 Å |
| b |
12.6583 ± 0.0009 Å |
| c |
12.8851 ± 0.0009 Å |
| α |
90° |
| β |
119.06 ± 0.002° |
| γ |
90° |
| Cell volume |
1830 ± 0.2 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0594 |
| Residual factor for significantly intense reflections |
0.0409 |
| Weighted residual factors for significantly intense reflections |
0.1042 |
| Weighted residual factors for all reflections included in the refinement |
0.116 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1548569.html