Information card for entry 1549342
| Chemical name |
1-[(1-Butyl-1<i>H</i>-1,2,3-triazol-5-yl)methyl]-3-methylquinoxalin-2(1<i>H</i>)-one |
| Formula |
C16 H19 N5 O |
| Calculated formula |
C16 H19 N5 O |
| SMILES |
O=c1n(Cc2n(nnc2)CCCC)c2c(nc1C)cccc2 |
| Title of publication |
1-[(1-Butyl-1<i>H</i>-1,2,3-triazol-5-yl)methyl]-3-methylquinoxalin-2(1<i>H</i>)-one |
| Authors of publication |
Abad, Nadeem; Ramli, Youssef; Sebbar, Nada Kheira; Kaur, Manpreet; Essassi, El Mokhtar; Jasinski, Jerry P. |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
4 |
| Pages of publication |
x180482 |
| a |
15.8299 ± 0.0008 Å |
| b |
10.627 ± 0.0004 Å |
| c |
9.2041 ± 0.0003 Å |
| α |
90° |
| β |
98.084 ± 0.004° |
| γ |
90° |
| Cell volume |
1532.97 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0715 |
| Residual factor for significantly intense reflections |
0.053 |
| Weighted residual factors for significantly intense reflections |
0.1423 |
| Weighted residual factors for all reflections included in the refinement |
0.1566 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.023 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1549342.html