Information card for entry 1549345
| Chemical name |
2-(3-Chlorophenyl)-3,4-dihydrobenzo[<i>f</i>][1,4]oxazepin-5(2<i>H</i>)-one |
| Formula |
C15 H12 Cl N O2 |
| Calculated formula |
C15 H12 Cl N O2 |
| SMILES |
Clc1c(C2Oc3c(C(=O)NC2)cccc3)cccc1 |
| Title of publication |
2-(3-Chlorophenyl)-3,4-dihydrobenzo[<i>f</i>][1,4]oxazepin-5(2<i>H</i>)-one |
| Authors of publication |
Zhong, Ling; Shi, Jianyou; Zhong, Lei; Wei, Xin; Xhang, Hongjia; Cheng, Liang; Bai, Lan |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
4 |
| Pages of publication |
x180587 |
| a |
7.2162 ± 0.0015 Å |
| b |
8.0068 ± 0.0014 Å |
| c |
11.65 ± 0.003 Å |
| α |
80.123 ± 0.017° |
| β |
84.57 ± 0.018° |
| γ |
88.084 ± 0.015° |
| Cell volume |
660.1 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293.15 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0653 |
| Residual factor for significantly intense reflections |
0.0461 |
| Weighted residual factors for significantly intense reflections |
0.1042 |
| Weighted residual factors for all reflections included in the refinement |
0.1183 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1549345.html