Information card for entry 1549372
| Common name |
ROY R05 |
| Chemical name |
2-Methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile |
| Formula |
C12 H9 N3 O2 S |
| Calculated formula |
C12 H9 N3 O2 S |
| SMILES |
C(#N)c1cc(C)sc1Nc1c(cccc1)N(=O)=O |
| Title of publication |
ROY revisited, again: the eighth solved structure. |
| Authors of publication |
Tan, Melissa; Shtukenberg, Alexander G.; Zhu, Shengcai; Xu, Wenqian; Dooryhee, Eric; Nichols, Shane M.; Ward, Michael D.; Kahr, Bart; Zhu, Qiang |
| Journal of publication |
Faraday discussions |
| Year of publication |
2018 |
| Journal volume |
211 |
| Journal issue |
0 |
| Pages of publication |
477 - 491 |
| a |
10.77117 ± 0.0005 Å |
| b |
11.01902 ± 0.00013 Å |
| c |
11.43023 ± 0.00026 Å |
| α |
90° |
| β |
117.742 ± 0.00023° |
| γ |
90° |
| Cell volume |
1200.68 ± 0.06 Å3 |
| Cell temperature |
250 K |
| Ambient diffraction temperature |
250 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor R(I) for significantly intense reflections |
1.783 |
| Goodness-of-fit parameter for all reflections |
0.208 |
| Method of determination |
powder diffraction |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.18342 Å |
| Diffraction radiation type |
synchrotron |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1549372.html