Information card for entry 1550612
| Formula |
C37 H32 B F15 Ge N2 O2 |
| Calculated formula |
C37 H32 B F15 Ge N2 O2 |
| SMILES |
[Ge]1(O[B](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)(OC(C)(C)C)N(C2=CC=CC=CC2=[N]1CC(C)C)CC(C)C |
| Title of publication |
Donor-Acceptor-Stabilized Germanium Analogues of Acid Chloride, Ester, and Acyl Pyrrole Compounds: Synthesis and Reactivity |
| Authors of publication |
Sharma, Mahendra Kumar; Sinhababu, Soumen; Mahawar, Pritam; Mukherjee, Goutam; Pandey, Bhawana; Rajaraman, Gopalan; Selvarajan, Nagendran |
| Journal of publication |
Chemical Science |
| Year of publication |
2019 |
| a |
11.415 ± 0.003 Å |
| b |
38.762 ± 0.014 Å |
| c |
17.556 ± 0.006 Å |
| α |
90° |
| β |
96.277 ± 0.008° |
| γ |
90° |
| Cell volume |
7721 ± 4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1042 |
| Residual factor for significantly intense reflections |
0.056 |
| Weighted residual factors for significantly intense reflections |
0.0962 |
| Weighted residual factors for all reflections included in the refinement |
0.1068 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550612.html