Information card for entry 1551252
| Chemical name |
(4-Bromo-8-fluoro-5,6,7,8-tetrahydronaphthalen-1-yl)difluoro-λ3-iodane |
| Formula |
C10 H9 Br F3 I |
| Calculated formula |
C10 H9 Br F3 I |
| SMILES |
c1(ccc(c2c1C(CCC2)F)Br)[I](F)F |
| Title of publication |
Substituent-controlled, Mild Oxidative Fluorination of Iodoarenes: Synthesis and Structural Study of Aryl I(III)- and I(V)-Fluorides |
| Authors of publication |
Häfliger, Joel; Pitts, Cody Ross; Bornemann, Dustin; Käser, Roland; Santschi, Nico; Charpentier, Julie; Otth, Elisabeth; Trapp, Nils; Verel, René; Lüthi, Hans Peter; Togni, Antonio |
| Journal of publication |
Chemical Science |
| Year of publication |
2019 |
| a |
23.483 ± 0.002 Å |
| b |
8.4119 ± 0.0003 Å |
| c |
15.9818 ± 0.0015 Å |
| α |
90° |
| β |
134.61 ± 0.017° |
| γ |
90° |
| Cell volume |
2247.5 ± 0.7 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0322 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.0841 |
| Weighted residual factors for all reflections included in the refinement |
0.0848 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.109 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1551252.html