Information card for entry 1552643
| Formula |
C32 H36 O9 |
| Calculated formula |
C32 H36 O9 |
| SMILES |
C1CC2=C3[C@@](C)([C@@H](O)C(=O)C4=C3[C@@]31[C@]1(O)[C@]([C@H]5[C@@H]3C5)([C@@H](O)C(=O)/C(=C(/C)C(=O)OC)[C@@H]1[C@@]4(C)C(=O)OC)C)[C@@H]1C[C@H]21 |
| Title of publication |
Chloraserrtone A, a Sesquiterpenoid Dimer from Chloranthus serratus. |
| Authors of publication |
Bai, Bai; Ye, Shao-Xia; Yang, De-Po; Zhu, Long-Ping; Tang, Gui-Hua; Chen, Yun-Yun; Li, George Qian; Zhao, Zhi-Min |
| Journal of publication |
Journal of natural products |
| Year of publication |
2019 |
| Journal volume |
82 |
| Journal issue |
2 |
| Pages of publication |
407 - 411 |
| a |
10.07035 ± 0.00013 Å |
| b |
12.689 ± 0.0002 Å |
| c |
21.834 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2790.01 ± 0.08 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0549 |
| Residual factor for significantly intense reflections |
0.0481 |
| Weighted residual factors for significantly intense reflections |
0.1184 |
| Weighted residual factors for all reflections included in the refinement |
0.1262 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1552643.html