Information card for entry 1554693
| Formula |
C17 H19 N O2 |
| Calculated formula |
C17 H19 N O2 |
| SMILES |
O(c1ccc(/N=C/c2c(O)cccc2)cc1)CCCC |
| Title of publication |
Utilizing the aggregation-induced emission phenomenon to visualize spontaneous molecular directed motion in the solid state |
| Authors of publication |
Liu, Jianxun; Xing, Chang; Wei, Donghui; Deng, Qianqian; Yang, Cuiping; Peng, Qiuchen; Hou, Hongwei; Li, Yuanyuan; Li, Kai |
| Journal of publication |
Materials Chemistry Frontiers |
| Year of publication |
2019 |
| Journal volume |
3 |
| Journal issue |
12 |
| Pages of publication |
2746 |
| a |
6.1745 ± 0.0002 Å |
| b |
7.0411 ± 0.0002 Å |
| c |
33.2296 ± 0.001 Å |
| α |
86.545 ± 0.002° |
| β |
84.929 ± 0.002° |
| γ |
89.992 ± 0.002° |
| Cell volume |
1436.38 ± 0.08 Å3 |
| Cell temperature |
99.9 ± 0.2 K |
| Ambient diffraction temperature |
99.9 ± 0.2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0603 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for significantly intense reflections |
0.1264 |
| Weighted residual factors for all reflections included in the refinement |
0.1306 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.119 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1554693.html
