Information card for entry 1554897
| Chemical name |
Benzyl 8-azaspiro[bicyclo[3.2.1]octane-(exo)-3,2?-oxirane]-8-carboxylate |
| Formula |
C16 H19 N O3 |
| Calculated formula |
C16 H19 N O3 |
| SMILES |
[C@@H]12CC3(C[C@@H](CC1)N2C(=O)OCc1ccccc1)CO3 |
| Title of publication |
Selective synthesis of N-protected exo-spiro[oxirane-3,2′-tropanes] |
| Authors of publication |
Mandzhulo, Aleksandr; Vashchenko, Iryna; Gerasov, Andrii; Vovk, Mykhaylo; Rusanov, Eduard; Fetyukhin, Volodymyr; Lukin, Oleg; Shivanyuk, Alexander |
| Journal of publication |
Organic Chemistry Frontiers |
| Year of publication |
2019 |
| Journal volume |
6 |
| Journal issue |
10 |
| Pages of publication |
1692 |
| a |
7.9218 ± 0.0011 Å |
| b |
6.5193 ± 0.0008 Å |
| c |
13.434 ± 0.0016 Å |
| α |
90° |
| β |
101.58 ± 0.004° |
| γ |
90° |
| Cell volume |
679.67 ± 0.15 Å3 |
| Cell temperature |
173 ± 1 K |
| Ambient diffraction temperature |
173 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0391 |
| Residual factor for significantly intense reflections |
0.0337 |
| Weighted residual factors for significantly intense reflections |
0.0751 |
| Weighted residual factors for all reflections included in the refinement |
0.0772 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1554897.html