Information card for entry 1555218
| Formula |
C33 H23 Cl3 N2 O2 |
| Calculated formula |
C33 H23 Cl3 N2 O2 |
| SMILES |
O1Cc2c(c3c(cc2)cccc3)c2c(ccc3ccccc23)COc2c(nccc2)c2ncccc12.ClC(Cl)Cl |
| Title of publication |
Conformational and Optical Characteristics of Unidirectionally Twisted Binaphthyl-Bipyridyl Cyclic Dyads. |
| Authors of publication |
Takaishi, Kazuto; Suzuki, Jun; Yabe, Tatsuya; Asano, Hikaru; Nishikawa, Michihiro; Hashizume, Daisuke; Muranaka, Atsuya; Uchiyama, Masanobu; Yokoyama, Akihiro |
| Journal of publication |
Organic letters |
| Year of publication |
2015 |
| Journal volume |
17 |
| Journal issue |
16 |
| Pages of publication |
4098 - 4101 |
| a |
9.07268 ± 0.00016 Å |
| b |
11.9732 ± 0.0002 Å |
| c |
13.4535 ± 0.0003 Å |
| α |
90° |
| β |
106.945 ± 0.0007° |
| γ |
90° |
| Cell volume |
1397.99 ± 0.05 Å3 |
| Cell temperature |
165 K |
| Ambient diffraction temperature |
165 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0303 |
| Residual factor for significantly intense reflections |
0.0271 |
| Weighted residual factors for significantly intense reflections |
0.0631 |
| Weighted residual factors for all reflections included in the refinement |
0.0669 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1555218.html
