Information card for entry 1555562
| Formula |
C23 H30 F2 N2 O2 |
| Calculated formula |
C23 H30 F2 N2 O2 |
| SMILES |
FC(F)(/C=C(/C(=O)NC1CCCCC1)c1ccccc1)C(=O)NC1CCCCC1 |
| Title of publication |
Palladium-Catalyzed Regioselective Difluoroalkylation and Carbonylation of Alkynes. |
| Authors of publication |
Wang, Qiang; He, Yu-Tao; Zhao, Jia-Hui; Qiu, Yi-Feng; Zheng, Lan; Hu, Jing-Yuan; Yang, Yu-Chen; Liu, Xue-Yuan; Liang, Yong-Min |
| Journal of publication |
Organic letters |
| Year of publication |
2016 |
| Journal volume |
18 |
| Journal issue |
11 |
| Pages of publication |
2664 - 2667 |
| a |
13.5393 ± 0.0008 Å |
| b |
9.9243 ± 0.0004 Å |
| c |
17.0947 ± 0.001 Å |
| α |
90° |
| β |
103.566 ± 0.006° |
| γ |
90° |
| Cell volume |
2232.9 ± 0.2 Å3 |
| Cell temperature |
295.35 ± 0.1 K |
| Ambient diffraction temperature |
295.35 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1148 |
| Residual factor for significantly intense reflections |
0.0632 |
| Weighted residual factors for significantly intense reflections |
0.1678 |
| Weighted residual factors for all reflections included in the refinement |
0.2101 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1555562.html