Information card for entry 1555571
| Chemical name |
(4aS,4bR,6R,10bR)-8,9-dimethoxy-1,1,4a,10b-tetramethyl-7-nitro-1,2,3,4,4a,4b,5,6,10b,11,12,12a,-dodecahydrochrysen-6-ol |
| Formula |
C24 H35 N O5 |
| Calculated formula |
C24 H35 N O5 |
| SMILES |
O[C@H]1c2c([C@@]3(CC[C@H]4C(CCC[C@@]4([C@H]3C1)C)(C)C)C)cc(OC)c(OC)c2N(=O)=O |
| Title of publication |
Expanding Diversity without Protecting Groups: (+)-Sclareolide to Indolosesquiterpene Alkaloid Mycoleptodiscin A and Analogues. |
| Authors of publication |
Nagaraju, Karre; Chegondi, Rambabu; Chandrasekhar, Srivari |
| Journal of publication |
Organic letters |
| Year of publication |
2016 |
| Journal volume |
18 |
| Journal issue |
11 |
| Pages of publication |
2684 - 2687 |
| a |
5.9846 ± 0.0016 Å |
| b |
7.913 ± 0.002 Å |
| c |
12.691 ± 0.003 Å |
| α |
99.814 ± 0.01° |
| β |
95.953 ± 0.009° |
| γ |
107.509 ± 0.01° |
| Cell volume |
557 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.096 |
| Residual factor for significantly intense reflections |
0.0617 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Weighted residual factors for all reflections included in the refinement |
0.1429 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1555571.html