Information card for entry 1556963
| Formula |
C27 H37 Cl2 Cu N7 O8 |
| Calculated formula |
C27 Cl2 Cu N7 O8 |
| SMILES |
[Cu]12345[N]6(CC[N]1(CC[N]2(CC[N]3(CC6)Cc1ncccc1)Cc1[n]5cccc1)C)Cc1[n]4cccc1.Cl(=O)(=O)(=O)[O-].Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Synthesis and Crystal Structure of the Copper(II) Complex of 1-Methyl-4,7,10-(2-pyridylmethyl)-1,4,7,10-tetraazacyclododecane (L), [CuL]2+ |
| Authors of publication |
Bu, Xian-He; Chen, Wei; Fang, Ya-Yin; Lu, Shou-Liang; Wang, Chang-Feng; Zhang, Ruo-Hua |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1998 |
| Journal volume |
52 |
| Pages of publication |
813 - 815 |
| a |
10.175 ± 0.002 Å |
| b |
15.191 ± 0.003 Å |
| c |
20.79 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3213.5 ± 1.1 Å3 |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
6 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P 21 c n |
| Hall space group symbol |
P -2n 2a |
| Residual factor for significantly intense reflections |
0.072 |
| Weighted residual factors for significantly intense reflections |
0.074 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1556963.html