Information card for entry 1557205
| Formula |
C23 H28 O8 |
| Calculated formula |
C23 H28 O8 |
| SMILES |
O([C@@H]1C2=C([C@]3(C(=O)O[C@H](c4cocc4)C3)[C@@H](C1)C)CCC[C@@]2(C(=O)OC)CO)C(=O)C |
| Title of publication |
19-nor-, 20-nor-, and tetranor-Halimane-Type Furanoditerpenoids from Croton crassifolius |
| Authors of publication |
Wang, Rong; Fan, Run-Zhu; Ni, Fu-Qiang; Sang, Jun; Xie, Xing-Lin; Luo, Si-Yuan; Tang, Gui-Hua; Yin, Sheng |
| Journal of publication |
Journal of Natural Products |
| Year of publication |
2020 |
| a |
7.9019 ± 0.0001 Å |
| b |
10.2955 ± 0.0001 Å |
| c |
25.9952 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2114.81 ± 0.05 Å3 |
| Cell temperature |
100.01 ± 0.1 K |
| Ambient diffraction temperature |
100.01 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0368 |
| Residual factor for significantly intense reflections |
0.0353 |
| Weighted residual factors for significantly intense reflections |
0.0976 |
| Weighted residual factors for all reflections included in the refinement |
0.0988 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.106 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1557205.html